C13H19NO2 — CID 14413604
(4R,5R)-4-methyl-2-prop-2-enyl-2-azaspiro[4.5]decane-1,6-dione (PubChem CID 14413604) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (4R,5R)-4-methyl-2-prop-2-enyl-2-azaspiro[4.5]decane-1,6-dione.
| Compound Name | (4R,5R)-4-methyl-2-prop-2-enyl-2-azaspiro[4.5]decane-1,6-dione |
|---|---|
| PubChem CID | 14413604 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (4R,5R)-4-methyl-2-prop-2-enyl-2-azaspiro[4.5]decane-1,6-dione |
| SMILES | C=CCN1C[C@H](C)[C@@]2(CCCCC2=O)C1=O |
| InChI | InChI=1S/C13H19NO2/c1-3-8-14-9-10(2)13(12(14)16)7-5-4-6-11(13)15/h3,10H,1,4-9H2,2H3/t10-,13+/m0/s1 |
| InChIKey | UPRUMJRKOAZXDQ-GXFFZTMASA-N |
| XLogP | 1.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|