C12H19NO2 — CID 10856726
2-(2-cyclohexyl-5-methyl-1,3-oxazol-4-yl)ethanol (PubChem CID 10856726) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-(2-cyclohexyl-5-methyl-1,3-oxazol-4-yl)ethanol.
| Compound Name | 2-(2-cyclohexyl-5-methyl-1,3-oxazol-4-yl)ethanol |
|---|---|
| PubChem CID | 10856726 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 2-(2-cyclohexyl-5-methyl-1,3-oxazol-4-yl)ethanol |
| SMILES | Cc1oc(C2CCCCC2)nc1CCO |
| InChI | InChI=1S/C12H19NO2/c1-9-11(7-8-14)13-12(15-9)10-5-3-2-4-6-10/h10,14H,2-8H2,1H3 |
| InChIKey | GDHMDXZIPQXVCU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |