C12H17NO3 — CID 10857080
2-(2-cyclohexyl-5-methyl-1,3-oxazol-4-yl)acetic acid (PubChem CID 10857080) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-(2-cyclohexyl-5-methyl-1,3-oxazol-4-yl)acetic acid.
| Compound Name | 2-(2-cyclohexyl-5-methyl-1,3-oxazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 10857080 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-(2-cyclohexyl-5-methyl-1,3-oxazol-4-yl)acetic acid |
| SMILES | Cc1oc(C2CCCCC2)nc1CC(=O)O |
| InChI | InChI=1S/C12H17NO3/c1-8-10(7-11(14)15)13-12(16-8)9-5-3-2-4-6-9/h9H,2-7H2,1H3,(H,14,15) |
| InChIKey | MMDWSADAQQWYMT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |