C19H26N2O6 — CID 108567802
ethyl 4-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]-4-oxobutanoate (PubChem CID 108567802) has the molecular formula C19H26N2O6 and a molecular weight of 378.43 g/mol. Its IUPAC name is ethyl 4-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]-4-oxobutanoate.
| Compound Name | ethyl 4-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 108567802 |
| Molecular Formula | C19H26N2O6 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | ethyl 4-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N1CCN(C(=O)c2c(OC)cccc2OC)CC1 |
| InChI | InChI=1S/C19H26N2O6/c1-4-27-17(23)9-8-16(22)20-10-12-21(13-11-20)19(24)18-14(25-2)6-5-7-15(18)26-3/h5-7H,4,8-13H2,1-3H3 |
| InChIKey | XPEBWZUCGONVBF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |