C19H27ClN2O3 — CID 108568061
3-chloro-1-[4-[2-(2,4-dimethylphenoxy)acetyl]piperazin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 108568061) has the molecular formula C19H27ClN2O3 and a molecular weight of 366.89 g/mol. Its IUPAC name is 3-chloro-1-[4-[2-(2,4-dimethylphenoxy)acetyl]piperazin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 3-chloro-1-[4-[2-(2,4-dimethylphenoxy)acetyl]piperazin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 108568061 |
| Molecular Formula | C19H27ClN2O3 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 3-chloro-1-[4-[2-(2,4-dimethylphenoxy)acetyl]piperazin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | Cc1ccc(OCC(=O)N2CCN(C(=O)C(C)(C)CCl)CC2)c(C)c1 |
| InChI | InChI=1S/C19H27ClN2O3/c1-14-5-6-16(15(2)11-14)25-12-17(23)21-7-9-22(10-8-21)18(24)19(3,4)13-20/h5-6,11H,7-10,12-13H2,1-4H3 |
| InChIKey | OWSUFLGDVCMSNB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|