C16H20N4O6S — CID 108568165
[4-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperazin-1-yl]-(3,4,5-trihydroxyphenyl)methanone (PubChem CID 108568165) has the molecular formula C16H20N4O6S and a molecular weight of 396.43 g/mol. Its IUPAC name is [4-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperazin-1-yl]-(3,4,5-trihydroxyphenyl)methanone.
| Compound Name | [4-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperazin-1-yl]-(3,4,5-trihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 108568165 |
| Molecular Formula | C16H20N4O6S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | [4-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperazin-1-yl]-(3,4,5-trihydroxyphenyl)methanone |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N1CCN(C(=O)c2cc(O)c(O)c(O)c2)CC1 |
| InChI | InChI=1S/C16H20N4O6S/c1-9-15(10(2)18-17-9)27(25,26)20-5-3-19(4-6-20)16(24)11-7-12(21)14(23)13(22)8-11/h7-8,21-23H,3-6H2,1-2H3,(H,17,18) |
| InChIKey | XJDOMONYYKUWRD-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 147.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|