C16H20Cl2N2O4 — CID 108568641
2,2-dichloro-1-[4-[2-(2-ethoxyphenoxy)acetyl]piperazin-1-yl]ethanone (PubChem CID 108568641) has the molecular formula C16H20Cl2N2O4 and a molecular weight of 375.25 g/mol. Its IUPAC name is 2,2-dichloro-1-[4-[2-(2-ethoxyphenoxy)acetyl]piperazin-1-yl]ethanone.
| Compound Name | 2,2-dichloro-1-[4-[2-(2-ethoxyphenoxy)acetyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 108568641 |
| Molecular Formula | C16H20Cl2N2O4 |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 2,2-dichloro-1-[4-[2-(2-ethoxyphenoxy)acetyl]piperazin-1-yl]ethanone |
| SMILES | CCOc1ccccc1OCC(=O)N1CCN(C(=O)C(Cl)Cl)CC1 |
| InChI | InChI=1S/C16H20Cl2N2O4/c1-2-23-12-5-3-4-6-13(12)24-11-14(21)19-7-9-20(10-8-19)16(22)15(17)18/h3-6,15H,2,7-11H2,1H3 |
| InChIKey | RJTATWCTDIWYKO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|