C22H27ClN2O3 — CID 55563553
1-[4-[1-(2-chlorophenyl)ethyl]piperazin-1-yl]-2-(2-ethoxyphenoxy)ethanone (PubChem CID 55563553) has the molecular formula C22H27ClN2O3 and a molecular weight of 402.92 g/mol. Its IUPAC name is 1-[4-[1-(2-chlorophenyl)ethyl]piperazin-1-yl]-2-(2-ethoxyphenoxy)ethanone.
| Compound Name | 1-[4-[1-(2-chlorophenyl)ethyl]piperazin-1-yl]-2-(2-ethoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 55563553 |
| Molecular Formula | C22H27ClN2O3 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-[4-[1-(2-chlorophenyl)ethyl]piperazin-1-yl]-2-(2-ethoxyphenoxy)ethanone |
| SMILES | CCOc1ccccc1OCC(=O)N1CCN(C(C)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C22H27ClN2O3/c1-3-27-20-10-6-7-11-21(20)28-16-22(26)25-14-12-24(13-15-25)17(2)18-8-4-5-9-19(18)23/h4-11,17H,3,12-16H2,1-2H3 |
| InChIKey | USOUSDPXBLTROV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |