C11H19NO4 — CID 10857232
Methyl 2-((tert-butoxycarbonyl)amino)pent-4-enoate (PubChem CID 10857232) has the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. Its IUPAC name is methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate.
| Compound Name | Methyl 2-((tert-butoxycarbonyl)amino)pent-4-enoate |
|---|---|
| PubChem CID | 10857232 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
| SMILES | CC(C)(C)OC(=O)NC(CC=C)C(=O)OC |
| InChI | InChI=1S/C11H19NO4/c1-6-7-8(9(13)15-5)12-10(14)16-11(2,3)4/h6,8H,1,7H2,2-5H3,(H,12,14) |
| InChIKey | APXWRHACXBILLH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | 268 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|