C10H20N2O3S — CID 108573610
N-[2-(butylsulfonylamino)ethyl]cyclopropanecarboxamide (PubChem CID 108573610) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is N-[2-(butylsulfonylamino)ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-(butylsulfonylamino)ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 108573610 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N-[2-(butylsulfonylamino)ethyl]cyclopropanecarboxamide |
| SMILES | CCCCS(=O)(=O)NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C10H20N2O3S/c1-2-3-8-16(14,15)12-7-6-11-10(13)9-4-5-9/h9,12H,2-8H2,1H3,(H,11,13) |
| InChIKey | GLBPFUVFDLOCQX-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|