C13H19NO3 — CID 10857488
(1S,6R)-1-benzyl-6-methyl-1-oxidopiperidin-1-ium-3,4-diol (PubChem CID 10857488) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is (1S,6R)-1-benzyl-6-methyl-1-oxidopiperidin-1-ium-3,4-diol.
| Compound Name | (1S,6R)-1-benzyl-6-methyl-1-oxidopiperidin-1-ium-3,4-diol |
|---|---|
| PubChem CID | 10857488 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | (1S,6R)-1-benzyl-6-methyl-1-oxidopiperidin-1-ium-3,4-diol |
| SMILES | C[C@@H]1CC(O)C(O)C[N@@+]1([O-])Cc1ccccc1 |
| InChI | InChI=1S/C13H19NO3/c1-10-7-12(15)13(16)9-14(10,17)8-11-5-3-2-4-6-11/h2-6,10,12-13,15-16H,7-9H2,1H3/t10-,12?,13?,14+/m1/s1 |
| InChIKey | ITEOWGPCKRHSID-OFVDZJKFSA-N |
| XLogP | 1.02 |
| TPSA | 63.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|