C12H18O5 — CID 10857643
(1R,2S,6R,7R,8S)-7-(hydroxymethyl)-4,4-dimethyl-3,5,10-trioxatricyclo[6.4.0.02,6]dodecan-11-one (PubChem CID 10857643) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is (1R,2S,6R,7R,8S)-7-(hydroxymethyl)-4,4-dimethyl-3,5,10-trioxatricyclo[6.4.0.02,6]dodecan-11-one.
| Compound Name | (1R,2S,6R,7R,8S)-7-(hydroxymethyl)-4,4-dimethyl-3,5,10-trioxatricyclo[6.4.0.02,6]dodecan-11-one |
|---|---|
| PubChem CID | 10857643 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (1R,2S,6R,7R,8S)-7-(hydroxymethyl)-4,4-dimethyl-3,5,10-trioxatricyclo[6.4.0.02,6]dodecan-11-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO)[C@H]3COC(=O)C[C@H]3[C@@H]2O1 |
| InChI | InChI=1S/C12H18O5/c1-12(2)16-10-6-3-9(14)15-5-8(6)7(4-13)11(10)17-12/h6-8,10-11,13H,3-5H2,1-2H3/t6-,7+,8+,10+,11-/m1/s1 |
| InChIKey | VQOYAICPMKSHDI-RLMMANCXSA-N |
| XLogP | 0.31 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |