C13H14N4O — CID 10857646
N'-(2-cyanoethyl)-2-(1H-indol-3-yl)acetohydrazide (PubChem CID 10857646) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-2-(1H-indol-3-yl)acetohydrazide.
| Compound Name | N'-(2-cyanoethyl)-2-(1H-indol-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 10857646 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N'-(2-cyanoethyl)-2-(1H-indol-3-yl)acetohydrazide |
| SMILES | N#CCCNNC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C13H14N4O/c14-6-3-7-16-17-13(18)8-10-9-15-12-5-2-1-4-11(10)12/h1-2,4-5,9,15-16H,3,7-8H2,(H,17,18) |
| InChIKey | GIUXTKZRARPJIO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 80.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|