C21H20FNO4 — CID 108578641
1-(3-fluorophenyl)-4-hydroxy-2-(2-methoxyphenyl)-3-(2-methylpropanoyl)-2H-pyrrol-5-one (PubChem CID 108578641) has the molecular formula C21H20FNO4 and a molecular weight of 369.39 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-4-hydroxy-2-(2-methoxyphenyl)-3-(2-methylpropanoyl)-2H-pyrrol-5-one.
| Compound Name | 1-(3-fluorophenyl)-4-hydroxy-2-(2-methoxyphenyl)-3-(2-methylpropanoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108578641 |
| Molecular Formula | C21H20FNO4 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-(3-fluorophenyl)-4-hydroxy-2-(2-methoxyphenyl)-3-(2-methylpropanoyl)-2H-pyrrol-5-one |
| SMILES | COc1ccccc1C1C(C(=O)C(C)C)=C(O)C(=O)N1c1cccc(F)c1 |
| InChI | InChI=1S/C21H20FNO4/c1-12(2)19(24)17-18(15-9-4-5-10-16(15)27-3)23(21(26)20(17)25)14-8-6-7-13(22)11-14/h4-12,18,25H,1-3H3 |
| InChIKey | KNRSYTFBWJJNPH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |