C22H16FNO5 — CID 108578646
1-(3-fluorophenyl)-3-(furan-2-carbonyl)-4-hydroxy-2-(2-methoxyphenyl)-2H-pyrrol-5-one (PubChem CID 108578646) has the molecular formula C22H16FNO5 and a molecular weight of 393.37 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-(furan-2-carbonyl)-4-hydroxy-2-(2-methoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 1-(3-fluorophenyl)-3-(furan-2-carbonyl)-4-hydroxy-2-(2-methoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108578646 |
| Molecular Formula | C22H16FNO5 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 1-(3-fluorophenyl)-3-(furan-2-carbonyl)-4-hydroxy-2-(2-methoxyphenyl)-2H-pyrrol-5-one |
| SMILES | COc1ccccc1C1C(C(=O)c2ccco2)=C(O)C(=O)N1c1cccc(F)c1 |
| InChI | InChI=1S/C22H16FNO5/c1-28-16-9-3-2-8-15(16)19-18(20(25)17-10-5-11-29-17)21(26)22(27)24(19)14-7-4-6-13(23)12-14/h2-12,19,26H,1H3 |
| InChIKey | MHERMYVGENWSSH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |