C21H13ClFNO4 — CID 108602937
1-(3-chlorophenyl)-2-(2-fluorophenyl)-3-(furan-2-carbonyl)-4-hydroxy-2H-pyrrol-5-one (PubChem CID 108602937) has the molecular formula C21H13ClFNO4 and a molecular weight of 397.79 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-(2-fluorophenyl)-3-(furan-2-carbonyl)-4-hydroxy-2H-pyrrol-5-one.
| Compound Name | 1-(3-chlorophenyl)-2-(2-fluorophenyl)-3-(furan-2-carbonyl)-4-hydroxy-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108602937 |
| Molecular Formula | C21H13ClFNO4 |
| Molecular Weight | 397.79 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 1-(3-chlorophenyl)-2-(2-fluorophenyl)-3-(furan-2-carbonyl)-4-hydroxy-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(c2cccc(Cl)c2)C1c1ccccc1F)c1ccco1 |
| InChI | InChI=1S/C21H13ClFNO4/c22-12-5-3-6-13(11-12)24-18(14-7-1-2-8-15(14)23)17(20(26)21(24)27)19(25)16-9-4-10-28-16/h1-11,18,26H |
| InChIKey | CUVFSCDCZZIDEV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.79 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |