C21H14BrNO4 — CID 108678293
1-(3-bromophenyl)-3-(furan-2-carbonyl)-4-hydroxy-2-phenyl-2H-pyrrol-5-one (PubChem CID 108678293) has the molecular formula C21H14BrNO4 and a molecular weight of 424.25 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(furan-2-carbonyl)-4-hydroxy-2-phenyl-2H-pyrrol-5-one.
| Compound Name | 1-(3-bromophenyl)-3-(furan-2-carbonyl)-4-hydroxy-2-phenyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108678293 |
| Molecular Formula | C21H14BrNO4 |
| Molecular Weight | 424.25 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | 1-(3-bromophenyl)-3-(furan-2-carbonyl)-4-hydroxy-2-phenyl-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(c2cccc(Br)c2)C1c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C21H14BrNO4/c22-14-8-4-9-15(12-14)23-18(13-6-2-1-3-7-13)17(20(25)21(23)26)19(24)16-10-5-11-27-16/h1-12,18,25H |
| InChIKey | LWNKCYQMRPOFHY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.25 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |