C19H12ClNO4S — CID 108587817
1-(3-chlorophenyl)-3-(furan-2-carbonyl)-4-hydroxy-2-thiophen-2-yl-2H-pyrrol-5-one (PubChem CID 108587817) has the molecular formula C19H12ClNO4S and a molecular weight of 385.83 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(furan-2-carbonyl)-4-hydroxy-2-thiophen-2-yl-2H-pyrrol-5-one.
| Compound Name | 1-(3-chlorophenyl)-3-(furan-2-carbonyl)-4-hydroxy-2-thiophen-2-yl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108587817 |
| Molecular Formula | C19H12ClNO4S |
| Molecular Weight | 385.83 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(furan-2-carbonyl)-4-hydroxy-2-thiophen-2-yl-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(c2cccc(Cl)c2)C1c1cccs1)c1ccco1 |
| InChI | InChI=1S/C19H12ClNO4S/c20-11-4-1-5-12(10-11)21-16(14-7-3-9-26-14)15(18(23)19(21)24)17(22)13-6-2-8-25-13/h1-10,16,23H |
| InChIKey | QHRALSIQQCFCNR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.83 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |