C21H18N2O4S — CID 108587034
1-[4-(dimethylamino)phenyl]-3-(furan-2-carbonyl)-4-hydroxy-2-thiophen-2-yl-2H-pyrrol-5-one (PubChem CID 108587034) has the molecular formula C21H18N2O4S and a molecular weight of 394.45 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-3-(furan-2-carbonyl)-4-hydroxy-2-thiophen-2-yl-2H-pyrrol-5-one.
| Compound Name | 1-[4-(dimethylamino)phenyl]-3-(furan-2-carbonyl)-4-hydroxy-2-thiophen-2-yl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108587034 |
| Molecular Formula | C21H18N2O4S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-3-(furan-2-carbonyl)-4-hydroxy-2-thiophen-2-yl-2H-pyrrol-5-one |
| SMILES | CN(C)c1ccc(N2C(=O)C(O)=C(C(=O)c3ccco3)C2c2cccs2)cc1 |
| InChI | InChI=1S/C21H18N2O4S/c1-22(2)13-7-9-14(10-8-13)23-18(16-6-4-12-28-16)17(20(25)21(23)26)19(24)15-5-3-11-27-15/h3-12,18,25H,1-2H3 |
| InChIKey | JZJNVVRRGCLJJP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|