C20H20N2O4 — CID 21008290
2-[4-(dimethylamino)phenyl]-3-(furan-2-carbonyl)-4-hydroxy-1-prop-2-enyl-2H-pyrrol-5-one (PubChem CID 21008290) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-3-(furan-2-carbonyl)-4-hydroxy-1-prop-2-enyl-2H-pyrrol-5-one.
| Compound Name | 2-[4-(dimethylamino)phenyl]-3-(furan-2-carbonyl)-4-hydroxy-1-prop-2-enyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 21008290 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-3-(furan-2-carbonyl)-4-hydroxy-1-prop-2-enyl-2H-pyrrol-5-one |
| SMILES | C=CCN1C(=O)C(O)=C(C(=O)c2ccco2)C1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H20N2O4/c1-4-11-22-17(13-7-9-14(10-8-13)21(2)3)16(19(24)20(22)25)18(23)15-6-5-12-26-15/h4-10,12,17,24H,1,11H2,2-3H3 |
| InChIKey | ZLJUHDWJGPUWCH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|