C23H27NO4 — CID 44858136
1-butyl-2-(4-tert-butylphenyl)-3-(furan-2-carbonyl)-4-hydroxy-2H-pyrrol-5-one (PubChem CID 44858136) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is 1-butyl-2-(4-tert-butylphenyl)-3-(furan-2-carbonyl)-4-hydroxy-2H-pyrrol-5-one.
| Compound Name | 1-butyl-2-(4-tert-butylphenyl)-3-(furan-2-carbonyl)-4-hydroxy-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 44858136 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1-butyl-2-(4-tert-butylphenyl)-3-(furan-2-carbonyl)-4-hydroxy-2H-pyrrol-5-one |
| SMILES | CCCCN1C(=O)C(O)=C(C(=O)c2ccco2)C1c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H27NO4/c1-5-6-13-24-19(15-9-11-16(12-10-15)23(2,3)4)18(21(26)22(24)27)20(25)17-8-7-14-28-17/h7-12,14,19,26H,5-6,13H2,1-4H3 |
| InChIKey | GEBQFQXNERKESU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |