C23H18BrNO4 — CID 3401778
2-(4-bromophenyl)-3-(furan-2-carbonyl)-4-hydroxy-1-(2-phenylethyl)-2H-pyrrol-5-one (PubChem CID 3401778) has the molecular formula C23H18BrNO4 and a molecular weight of 452.30 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3-(furan-2-carbonyl)-4-hydroxy-1-(2-phenylethyl)-2H-pyrrol-5-one.
| Compound Name | 2-(4-bromophenyl)-3-(furan-2-carbonyl)-4-hydroxy-1-(2-phenylethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3401778 |
| Molecular Formula | C23H18BrNO4 |
| Molecular Weight | 452.30 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 2-(4-bromophenyl)-3-(furan-2-carbonyl)-4-hydroxy-1-(2-phenylethyl)-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(CCc2ccccc2)C1c1ccc(Br)cc1)c1ccco1 |
| InChI | InChI=1S/C23H18BrNO4/c24-17-10-8-16(9-11-17)20-19(21(26)18-7-4-14-29-18)22(27)23(28)25(20)13-12-15-5-2-1-3-6-15/h1-11,14,20,27H,12-13H2 |
| InChIKey | RCUQZFSNBJQKOG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.30 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |