C23H19NO5 — CID 3402408
3-(furan-2-carbonyl)-4-hydroxy-2-(3-hydroxyphenyl)-1-(2-phenylethyl)-2H-pyrrol-5-one (PubChem CID 3402408) has the molecular formula C23H19NO5 and a molecular weight of 389.41 g/mol. Its IUPAC name is 3-(furan-2-carbonyl)-4-hydroxy-2-(3-hydroxyphenyl)-1-(2-phenylethyl)-2H-pyrrol-5-one.
| Compound Name | 3-(furan-2-carbonyl)-4-hydroxy-2-(3-hydroxyphenyl)-1-(2-phenylethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3402408 |
| Molecular Formula | C23H19NO5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 3-(furan-2-carbonyl)-4-hydroxy-2-(3-hydroxyphenyl)-1-(2-phenylethyl)-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(CCc2ccccc2)C1c1cccc(O)c1)c1ccco1 |
| InChI | InChI=1S/C23H19NO5/c25-17-9-4-8-16(14-17)20-19(21(26)18-10-5-13-29-18)22(27)23(28)24(20)12-11-15-6-2-1-3-7-15/h1-10,13-14,20,25,27H,11-12H2 |
| InChIKey | PXEVIOMUPLFUMP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |