C18H17NO6 — CID 2917899
3-(furan-2-carbonyl)-4-hydroxy-2-(3-hydroxyphenyl)-1-(2-methoxyethyl)-2H-pyrrol-5-one (PubChem CID 2917899) has the molecular formula C18H17NO6 and a molecular weight of 343.34 g/mol. Its IUPAC name is 3-(furan-2-carbonyl)-4-hydroxy-2-(3-hydroxyphenyl)-1-(2-methoxyethyl)-2H-pyrrol-5-one.
| Compound Name | 3-(furan-2-carbonyl)-4-hydroxy-2-(3-hydroxyphenyl)-1-(2-methoxyethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 2917899 |
| Molecular Formula | C18H17NO6 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 3-(furan-2-carbonyl)-4-hydroxy-2-(3-hydroxyphenyl)-1-(2-methoxyethyl)-2H-pyrrol-5-one |
| SMILES | COCCN1C(=O)C(O)=C(C(=O)c2ccco2)C1c1cccc(O)c1 |
| InChI | InChI=1S/C18H17NO6/c1-24-9-7-19-15(11-4-2-5-12(20)10-11)14(17(22)18(19)23)16(21)13-6-3-8-25-13/h2-6,8,10,15,20,22H,7,9H2,1H3 |
| InChIKey | BTVHMVLPZJNJGR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |