C22H25IN2O4 — CID 3375667
1-[3-(diethylamino)propyl]-3-(furan-2-carbonyl)-4-hydroxy-2-(4-iodophenyl)-2H-pyrrol-5-one (PubChem CID 3375667) has the molecular formula C22H25IN2O4 and a molecular weight of 508.36 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-3-(furan-2-carbonyl)-4-hydroxy-2-(4-iodophenyl)-2H-pyrrol-5-one.
| Compound Name | 1-[3-(diethylamino)propyl]-3-(furan-2-carbonyl)-4-hydroxy-2-(4-iodophenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3375667 |
| Molecular Formula | C22H25IN2O4 |
| Molecular Weight | 508.36 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-3-(furan-2-carbonyl)-4-hydroxy-2-(4-iodophenyl)-2H-pyrrol-5-one |
| SMILES | CCN(CC)CCCN1C(=O)C(O)=C(C(=O)c2ccco2)C1c1ccc(I)cc1 |
| InChI | InChI=1S/C22H25IN2O4/c1-3-24(4-2)12-6-13-25-19(15-8-10-16(23)11-9-15)18(21(27)22(25)28)20(26)17-7-5-14-29-17/h5,7-11,14,19,27H,3-4,6,12-13H2,1-2H3 |
| InChIKey | FHDJMJPRYQITFW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|