C21H23NO6 — CID 108618033
3-(furan-2-carbonyl)-4-hydroxy-2-(4-hydroxyphenyl)-1-(3-propan-2-yloxypropyl)-2H-pyrrol-5-one (PubChem CID 108618033) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is 3-(furan-2-carbonyl)-4-hydroxy-2-(4-hydroxyphenyl)-1-(3-propan-2-yloxypropyl)-2H-pyrrol-5-one.
| Compound Name | 3-(furan-2-carbonyl)-4-hydroxy-2-(4-hydroxyphenyl)-1-(3-propan-2-yloxypropyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108618033 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 3-(furan-2-carbonyl)-4-hydroxy-2-(4-hydroxyphenyl)-1-(3-propan-2-yloxypropyl)-2H-pyrrol-5-one |
| SMILES | CC(C)OCCCN1C(=O)C(O)=C(C(=O)c2ccco2)C1c1ccc(O)cc1 |
| InChI | InChI=1S/C21H23NO6/c1-13(2)27-12-4-10-22-18(14-6-8-15(23)9-7-14)17(20(25)21(22)26)19(24)16-5-3-11-28-16/h3,5-9,11,13,18,23,25H,4,10,12H2,1-2H3 |
| InChIKey | NYJWNVAOZMHXGC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|