C22H19N3O3S — CID 108590801
1-[4-(dimethylamino)phenyl]-4-hydroxy-2-pyridin-3-yl-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 108590801) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-4-hydroxy-2-pyridin-3-yl-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 1-[4-(dimethylamino)phenyl]-4-hydroxy-2-pyridin-3-yl-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108590801 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-4-hydroxy-2-pyridin-3-yl-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | CN(C)c1ccc(N2C(=O)C(O)=C(C(=O)c3cccs3)C2c2cccnc2)cc1 |
| InChI | InChI=1S/C22H19N3O3S/c1-24(2)15-7-9-16(10-8-15)25-19(14-5-3-11-23-13-14)18(21(27)22(25)28)20(26)17-6-4-12-29-17/h3-13,19,27H,1-2H3 |
| InChIKey | HOSVPLRGVYKOJK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|