C13H24O3Si — CID 10858104
[(1E,3E)-5-[tert-butyl(dimethyl)silyl]oxypenta-1,3-dienyl] acetate (PubChem CID 10858104) has the molecular formula C13H24O3Si and a molecular weight of 256.42 g/mol. Its IUPAC name is [(1E,3E)-5-[tert-butyl(dimethyl)silyl]oxypenta-1,3-dienyl] acetate.
| Compound Name | [(1E,3E)-5-[tert-butyl(dimethyl)silyl]oxypenta-1,3-dienyl] acetate |
|---|---|
| PubChem CID | 10858104 |
| Molecular Formula | C13H24O3Si |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | [(1E,3E)-5-[tert-butyl(dimethyl)silyl]oxypenta-1,3-dienyl] acetate |
| SMILES | CC(=O)O/C=C/C=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H24O3Si/c1-12(14)15-10-8-7-9-11-16-17(5,6)13(2,3)4/h7-10H,11H2,1-6H3/b9-7+,10-8+ |
| InChIKey | ZPVLLCBUSTXGOX-FIFLTTCUSA-N |
| XLogP | 3.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|