C13H22O3S — CID 10858166
(3S,4aR,8aR)-3-tert-butyl-5-methyl-3,4,4a,7,8,8a-hexahydro-2,1λ6-benzoxathiine 1,1-dioxide (PubChem CID 10858166) has the molecular formula C13H22O3S and a molecular weight of 258.38 g/mol. Its IUPAC name is (3S,4aR,8aR)-3-tert-butyl-5-methyl-3,4,4a,7,8,8a-hexahydro-2,1λ6-benzoxathiine 1,1-dioxide.
| Compound Name | (3S,4aR,8aR)-3-tert-butyl-5-methyl-3,4,4a,7,8,8a-hexahydro-2,1λ6-benzoxathiine 1,1-dioxide |
|---|---|
| PubChem CID | 10858166 |
| Molecular Formula | C13H22O3S |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (3S,4aR,8aR)-3-tert-butyl-5-methyl-3,4,4a,7,8,8a-hexahydro-2,1λ6-benzoxathiine 1,1-dioxide |
| SMILES | CC1=CCC[C@@H]2[C@@H]1C[C@@H](C(C)(C)C)OS2(=O)=O |
| InChI | InChI=1S/C13H22O3S/c1-9-6-5-7-11-10(9)8-12(13(2,3)4)16-17(11,14)15/h6,10-12H,5,7-8H2,1-4H3/t10-,11-,12+/m1/s1 |
| InChIKey | UMMRWQAWGUXFDB-UTUOFQBUSA-N |
| XLogP | 2.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|