C10H16O4S — CID 10331505
(3R,6R,7S,8aS)-3,6-dimethyl-1,1-dioxo-3,4,6,7,8,8a-hexahydro-2,1λ6-benzoxathiin-7-ol (PubChem CID 10331505) has the molecular formula C10H16O4S and a molecular weight of 232.30 g/mol. Its IUPAC name is (3R,6R,7S,8aS)-3,6-dimethyl-1,1-dioxo-3,4,6,7,8,8a-hexahydro-2,1λ6-benzoxathiin-7-ol.
| Compound Name | (3R,6R,7S,8aS)-3,6-dimethyl-1,1-dioxo-3,4,6,7,8,8a-hexahydro-2,1λ6-benzoxathiin-7-ol |
|---|---|
| PubChem CID | 10331505 |
| Molecular Formula | C10H16O4S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | (3R,6R,7S,8aS)-3,6-dimethyl-1,1-dioxo-3,4,6,7,8,8a-hexahydro-2,1λ6-benzoxathiin-7-ol |
| SMILES | C[C@@H]1CC2=C[C@@H](C)[C@@H](O)C[C@@H]2S(=O)(=O)O1 |
| InChI | InChI=1S/C10H16O4S/c1-6-3-8-4-7(2)14-15(12,13)10(8)5-9(6)11/h3,6-7,9-11H,4-5H2,1-2H3/t6-,7-,9+,10+/m1/s1 |
| InChIKey | ZUMFLUCLDRYRFO-XFFJFQIUSA-N |
| XLogP | 0.82 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|