C12H20O4S — CID 162690579
2-hydroxy-1-[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl]ethanesulfonic acid (PubChem CID 162690579) has the molecular formula C12H20O4S and a molecular weight of 260.35 g/mol. Its IUPAC name is 2-hydroxy-1-[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl]ethanesulfonic acid.
| Compound Name | 2-hydroxy-1-[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 162690579 |
| Molecular Formula | C12H20O4S |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-hydroxy-1-[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl]ethanesulfonic acid |
| SMILES | C=C(C)[C@@H]1CCC(C)=C(C(CO)S(=O)(=O)O)C1 |
| InChI | InChI=1S/C12H20O4S/c1-8(2)10-5-4-9(3)11(6-10)12(7-13)17(14,15)16/h10,12-13H,1,4-7H2,2-3H3,(H,14,15,16)/t10-,12?/m1/s1 |
| InChIKey | PTJDLNLTTFQMIZ-RWANSRKNSA-N |
| XLogP | 1.93 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|