C15H18O4 — CID 10858266
ethyl 8-hydroxy-2,3-dimethyl-7-oxo-1,4-dihydronaphthalene-4a-carboxylate (PubChem CID 10858266) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is ethyl 8-hydroxy-2,3-dimethyl-7-oxo-1,4-dihydronaphthalene-4a-carboxylate.
| Compound Name | ethyl 8-hydroxy-2,3-dimethyl-7-oxo-1,4-dihydronaphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 10858266 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | ethyl 8-hydroxy-2,3-dimethyl-7-oxo-1,4-dihydronaphthalene-4a-carboxylate |
| SMILES | CCOC(=O)C12C=CC(=O)C(O)=C1CC(C)=C(C)C2 |
| InChI | InChI=1S/C15H18O4/c1-4-19-14(18)15-6-5-12(16)13(17)11(15)7-9(2)10(3)8-15/h5-6,17H,4,7-8H2,1-3H3 |
| InChIKey | PRIOUPGPKUCBRQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|