C18H20O5 — CID 72945344
methyl 8-hydroxy-3-methyl-4-[(Z)-3-methyl-4-oxobut-2-enyl]-7-oxo-1,4-dihydronaphthalene-4a-carboxylate (PubChem CID 72945344) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is methyl 8-hydroxy-3-methyl-4-[(Z)-3-methyl-4-oxobut-2-enyl]-7-oxo-1,4-dihydronaphthalene-4a-carboxylate.
| Compound Name | methyl 8-hydroxy-3-methyl-4-[(Z)-3-methyl-4-oxobut-2-enyl]-7-oxo-1,4-dihydronaphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 72945344 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | methyl 8-hydroxy-3-methyl-4-[(Z)-3-methyl-4-oxobut-2-enyl]-7-oxo-1,4-dihydronaphthalene-4a-carboxylate |
| SMILES | COC(=O)C12C=CC(=O)C(O)=C1CC=C(C)C2C/C=C(/C)C=O |
| InChI | InChI=1S/C18H20O5/c1-11(10-19)4-6-13-12(2)5-7-14-16(21)15(20)8-9-18(13,14)17(22)23-3/h4-5,8-10,13,21H,6-7H2,1-3H3/b11-4- |
| InChIKey | RAUJCVKRKJTBPY-WCIBSUBMSA-N |
| XLogP | 2.60 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|