C20H24O5 — CID 72945345
methyl 8-acetyloxy-3-methyl-4-(3-methylbut-2-enyl)-7-oxo-1,4-dihydronaphthalene-4a-carboxylate (PubChem CID 72945345) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is methyl 8-acetyloxy-3-methyl-4-(3-methylbut-2-enyl)-7-oxo-1,4-dihydronaphthalene-4a-carboxylate.
| Compound Name | methyl 8-acetyloxy-3-methyl-4-(3-methylbut-2-enyl)-7-oxo-1,4-dihydronaphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 72945345 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | methyl 8-acetyloxy-3-methyl-4-(3-methylbut-2-enyl)-7-oxo-1,4-dihydronaphthalene-4a-carboxylate |
| SMILES | COC(=O)C12C=CC(=O)C(OC(C)=O)=C1CC=C(C)C2CC=C(C)C |
| InChI | InChI=1S/C20H24O5/c1-12(2)6-8-15-13(3)7-9-16-18(25-14(4)21)17(22)10-11-20(15,16)19(23)24-5/h6-7,10-11,15H,8-9H2,1-5H3 |
| InChIKey | LUIKELAQLPRGNL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|