C17H24O4 — CID 71451467
ethyl (E)-2,4-dioxo-6-(2,6,6-trimethylcyclohex-2-en-1-yl)hex-5-enoate (PubChem CID 71451467) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is ethyl (E)-2,4-dioxo-6-(2,6,6-trimethylcyclohex-2-en-1-yl)hex-5-enoate.
| Compound Name | ethyl (E)-2,4-dioxo-6-(2,6,6-trimethylcyclohex-2-en-1-yl)hex-5-enoate |
|---|---|
| PubChem CID | 71451467 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | ethyl (E)-2,4-dioxo-6-(2,6,6-trimethylcyclohex-2-en-1-yl)hex-5-enoate |
| SMILES | CCOC(=O)C(=O)CC(=O)/C=C/C1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C17H24O4/c1-5-21-16(20)15(19)11-13(18)8-9-14-12(2)7-6-10-17(14,3)4/h7-9,14H,5-6,10-11H2,1-4H3/b9-8+ |
| InChIKey | LHFLNCLIEZNYTR-CMDGGOBGSA-N |
| XLogP | 3.02 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|