C22H30O4 — CID 59641663
[3,5,5-trimethyl-4-[(1E,3E,5E)-3-methylhepta-1,3,5-trienyl]-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate (PubChem CID 59641663) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is [3,5,5-trimethyl-4-[(1E,3E,5E)-3-methylhepta-1,3,5-trienyl]-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate.
| Compound Name | [3,5,5-trimethyl-4-[(1E,3E,5E)-3-methylhepta-1,3,5-trienyl]-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 59641663 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [3,5,5-trimethyl-4-[(1E,3E,5E)-3-methylhepta-1,3,5-trienyl]-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate |
| SMILES | C/C=C/C=C(C)/C=C/C1=C(C)C(=O)C(OC(=O)CCC(C)=O)CC1(C)C |
| InChI | InChI=1S/C22H30O4/c1-7-8-9-15(2)10-12-18-17(4)21(25)19(14-22(18,5)6)26-20(24)13-11-16(3)23/h7-10,12,19H,11,13-14H2,1-6H3/b8-7+,12-10+,15-9+ |
| InChIKey | UKPAZTMJHDDGIE-LRZXEGEJSA-N |
| XLogP | 4.66 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|