C17H23F3O2 — CID 163907038
6-methoxy-2,4,4-trimethyl-3-[(1E,3E)-6,6,6-trifluoro-3-methylhexa-1,3-dienyl]cyclohex-2-en-1-one (PubChem CID 163907038) has the molecular formula C17H23F3O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is 6-methoxy-2,4,4-trimethyl-3-[(1E,3E)-6,6,6-trifluoro-3-methylhexa-1,3-dienyl]cyclohex-2-en-1-one.
| Compound Name | 6-methoxy-2,4,4-trimethyl-3-[(1E,3E)-6,6,6-trifluoro-3-methylhexa-1,3-dienyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 163907038 |
| Molecular Formula | C17H23F3O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 6-methoxy-2,4,4-trimethyl-3-[(1E,3E)-6,6,6-trifluoro-3-methylhexa-1,3-dienyl]cyclohex-2-en-1-one |
| SMILES | COC1CC(C)(C)C(/C=C/C(C)=C/CC(F)(F)F)=C(C)C1=O |
| InChI | InChI=1S/C17H23F3O2/c1-11(8-9-17(18,19)20)6-7-13-12(2)15(21)14(22-5)10-16(13,3)4/h6-8,14H,9-10H2,1-5H3/b7-6+,11-8+ |
| InChIKey | QOVCJSYWJJZLHZ-HRCSPUOPSA-N |
| XLogP | 4.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|