C25H16F2N2O4 — CID 108583155
(4Z)-1-(2,5-difluorophenyl)-4-[hydroxy(1H-indol-3-yl)methylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108583155) has the molecular formula C25H16F2N2O4 and a molecular weight of 446.41 g/mol. Its IUPAC name is (4Z)-1-(2,5-difluorophenyl)-4-[hydroxy(1H-indol-3-yl)methylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(2,5-difluorophenyl)-4-[hydroxy(1H-indol-3-yl)methylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108583155 |
| Molecular Formula | C25H16F2N2O4 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | (4Z)-1-(2,5-difluorophenyl)-4-[hydroxy(1H-indol-3-yl)methylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2cc(F)ccc2F)C(c2ccc(O)cc2)/C1=C(/O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H16F2N2O4/c26-14-7-10-18(27)20(11-14)29-22(13-5-8-15(30)9-6-13)21(24(32)25(29)33)23(31)17-12-28-19-4-2-1-3-16(17)19/h1-12,22,28,30-31H/b23-21- |
| InChIKey | KNDOSPWYFWLLQF-LNVKXUELSA-N |
| XLogP | 4.78 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|