C25H16F2N2O3 — CID 108639609
(4Z)-1-(2,4-difluorophenyl)-4-[hydroxy(1H-indol-3-yl)methylidene]-5-phenylpyrrolidine-2,3-dione (PubChem CID 108639609) has the molecular formula C25H16F2N2O3 and a molecular weight of 430.41 g/mol. Its IUPAC name is (4Z)-1-(2,4-difluorophenyl)-4-[hydroxy(1H-indol-3-yl)methylidene]-5-phenylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(2,4-difluorophenyl)-4-[hydroxy(1H-indol-3-yl)methylidene]-5-phenylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108639609 |
| Molecular Formula | C25H16F2N2O3 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | (4Z)-1-(2,4-difluorophenyl)-4-[hydroxy(1H-indol-3-yl)methylidene]-5-phenylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2ccc(F)cc2F)C(c2ccccc2)/C1=C(/O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H16F2N2O3/c26-15-10-11-20(18(27)12-15)29-22(14-6-2-1-3-7-14)21(24(31)25(29)32)23(30)17-13-28-19-9-5-4-8-16(17)19/h1-13,22,28,30H/b23-21- |
| InChIKey | VHTMQZCGTNUWDF-LNVKXUELSA-N |
| XLogP | 5.07 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|