C23H15Cl2F2NO5S — CID 108588270
(4Z)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(2,4-difluorophenyl)-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 108588270) has the molecular formula C23H15Cl2F2NO5S and a molecular weight of 526.34 g/mol. Its IUPAC name is (4Z)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(2,4-difluorophenyl)-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(2,4-difluorophenyl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108588270 |
| Molecular Formula | C23H15Cl2F2NO5S |
| Molecular Weight | 526.34 g/mol |
| Exact Mass | 525.00 |
| IUPAC Name | (4Z)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(2,4-difluorophenyl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | COc1c(Cl)cc(/C(O)=C2/C(=O)C(=O)N(c3ccc(F)cc3F)C2c2cccs2)c(OC)c1Cl |
| InChI | InChI=1S/C23H15Cl2F2NO5S/c1-32-21-11(9-12(24)22(33-2)17(21)25)19(29)16-18(15-4-3-7-34-15)28(23(31)20(16)30)14-6-5-10(26)8-13(14)27/h3-9,18,29H,1-2H3/b19-16- |
| InChIKey | WXSHRBXZCNFZMN-MNDPQUGUSA-N |
| XLogP | 5.98 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.34 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|