C30H23Cl2NO6S — CID 108721886
(4Z)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(4-phenylmethoxyphenyl)-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 108721886) has the molecular formula C30H23Cl2NO6S and a molecular weight of 596.49 g/mol. Its IUPAC name is (4Z)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(4-phenylmethoxyphenyl)-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(4-phenylmethoxyphenyl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108721886 |
| Molecular Formula | C30H23Cl2NO6S |
| Molecular Weight | 596.49 g/mol |
| Exact Mass | 595.06 |
| IUPAC Name | (4Z)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(4-phenylmethoxyphenyl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | COc1c(Cl)cc(/C(O)=C2/C(=O)C(=O)N(c3ccc(OCc4ccccc4)cc3)C2c2cccs2)c(OC)c1Cl |
| InChI | InChI=1S/C30H23Cl2NO6S/c1-37-28-20(15-21(31)29(38-2)24(28)32)26(34)23-25(22-9-6-14-40-22)33(30(36)27(23)35)18-10-12-19(13-11-18)39-16-17-7-4-3-5-8-17/h3-15,25,34H,16H2,1-2H3/b26-23- |
| InChIKey | OAZXOXONNGIXMT-RWEWTDSWSA-N |
| XLogP | 7.28 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.49 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|