C27H23Cl2NO6S — CID 108721914
propan-2-yl 2-[4-[(4Z)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]phenyl]acetate (PubChem CID 108721914) has the molecular formula C27H23Cl2NO6S and a molecular weight of 560.46 g/mol. Its IUPAC name is propan-2-yl 2-[4-[(4Z)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]phenyl]acetate.
| Compound Name | propan-2-yl 2-[4-[(4Z)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]phenyl]acetate |
|---|---|
| PubChem CID | 108721914 |
| Molecular Formula | C27H23Cl2NO6S |
| Molecular Weight | 560.46 g/mol |
| Exact Mass | 559.06 |
| IUPAC Name | propan-2-yl 2-[4-[(4Z)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]phenyl]acetate |
| SMILES | COc1c(Cl)cc(Cl)cc1/C(O)=C1/C(=O)C(=O)N(c2ccc(CC(=O)OC(C)C)cc2)C1c1cccs1 |
| InChI | InChI=1S/C27H23Cl2NO6S/c1-14(2)36-21(31)11-15-6-8-17(9-7-15)30-23(20-5-4-10-37-20)22(25(33)27(30)34)24(32)18-12-16(28)13-19(29)26(18)35-3/h4-10,12-14,23,32H,11H2,1-3H3/b24-22- |
| InChIKey | RPJNCVXMJLKLFX-GYHWCHFESA-N |
| XLogP | 6.18 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.46 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|