C26H23NO5S — CID 108721903
propan-2-yl 2-[4-[(4Z)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]phenyl]acetate (PubChem CID 108721903) has the molecular formula C26H23NO5S and a molecular weight of 461.54 g/mol. Its IUPAC name is propan-2-yl 2-[4-[(4Z)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]phenyl]acetate.
| Compound Name | propan-2-yl 2-[4-[(4Z)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]phenyl]acetate |
|---|---|
| PubChem CID | 108721903 |
| Molecular Formula | C26H23NO5S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | propan-2-yl 2-[4-[(4Z)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]phenyl]acetate |
| SMILES | CC(C)OC(=O)Cc1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccccc3)C2c2cccs2)cc1 |
| InChI | InChI=1S/C26H23NO5S/c1-16(2)32-21(28)15-17-10-12-19(13-11-17)27-23(20-9-6-14-33-20)22(25(30)26(27)31)24(29)18-7-4-3-5-8-18/h3-14,16,23,29H,15H2,1-2H3/b24-22- |
| InChIKey | UHCZBUFCGCNBNH-GYHWCHFESA-N |
| XLogP | 4.87 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|