C28H26ClNO6S — CID 108721906
propan-2-yl 2-[4-[(4Z)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]phenyl]acetate (PubChem CID 108721906) has the molecular formula C28H26ClNO6S and a molecular weight of 540.04 g/mol. Its IUPAC name is propan-2-yl 2-[4-[(4Z)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]phenyl]acetate.
| Compound Name | propan-2-yl 2-[4-[(4Z)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]phenyl]acetate |
|---|---|
| PubChem CID | 108721906 |
| Molecular Formula | C28H26ClNO6S |
| Molecular Weight | 540.04 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | propan-2-yl 2-[4-[(4Z)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]phenyl]acetate |
| SMILES | CCOc1ccc(Cl)c(/C(O)=C2/C(=O)C(=O)N(c3ccc(CC(=O)OC(C)C)cc3)C2c2cccs2)c1 |
| InChI | InChI=1S/C28H26ClNO6S/c1-4-35-19-11-12-21(29)20(15-19)26(32)24-25(22-6-5-13-37-22)30(28(34)27(24)33)18-9-7-17(8-10-18)14-23(31)36-16(2)3/h5-13,15-16,25,32H,4,14H2,1-3H3/b26-24- |
| InChIKey | RFXGFPFXNNZYGD-LCUIJRPUSA-N |
| XLogP | 5.92 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.04 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|