C27H25NO6S — CID 108721893
propan-2-yl 2-[4-[(4Z)-4-[hydroxy-(2-methoxyphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]phenyl]acetate (PubChem CID 108721893) has the molecular formula C27H25NO6S and a molecular weight of 491.57 g/mol. Its IUPAC name is propan-2-yl 2-[4-[(4Z)-4-[hydroxy-(2-methoxyphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]phenyl]acetate.
| Compound Name | propan-2-yl 2-[4-[(4Z)-4-[hydroxy-(2-methoxyphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]phenyl]acetate |
|---|---|
| PubChem CID | 108721893 |
| Molecular Formula | C27H25NO6S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | propan-2-yl 2-[4-[(4Z)-4-[hydroxy-(2-methoxyphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]phenyl]acetate |
| SMILES | COc1ccccc1/C(O)=C1/C(=O)C(=O)N(c2ccc(CC(=O)OC(C)C)cc2)C1c1cccs1 |
| InChI | InChI=1S/C27H25NO6S/c1-16(2)34-22(29)15-17-10-12-18(13-11-17)28-24(21-9-6-14-35-21)23(26(31)27(28)32)25(30)19-7-4-5-8-20(19)33-3/h4-14,16,24,30H,15H2,1-3H3/b25-23- |
| InChIKey | NOMSOBJIKGYBHV-BZZOAKBMSA-N |
| XLogP | 4.88 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|