C27H24ClNO6S — CID 108722068
2-methylpropyl 4-[(4Z)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]benzoate (PubChem CID 108722068) has the molecular formula C27H24ClNO6S and a molecular weight of 526.01 g/mol. Its IUPAC name is 2-methylpropyl 4-[(4Z)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]benzoate.
| Compound Name | 2-methylpropyl 4-[(4Z)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108722068 |
| Molecular Formula | C27H24ClNO6S |
| Molecular Weight | 526.01 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | 2-methylpropyl 4-[(4Z)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]benzoate |
| SMILES | COc1ccc(Cl)cc1/C(O)=C1/C(=O)C(=O)N(c2ccc(C(=O)OCC(C)C)cc2)C1c1cccs1 |
| InChI | InChI=1S/C27H24ClNO6S/c1-15(2)14-35-27(33)16-6-9-18(10-7-16)29-23(21-5-4-12-36-21)22(25(31)26(29)32)24(30)19-13-17(28)8-11-20(19)34-3/h4-13,15,23,30H,14H2,1-3H3/b24-22- |
| InChIKey | LINZMBAVDATDKS-GYHWCHFESA-N |
| XLogP | 5.85 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.01 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|