C27H26ClN3O4S — CID 108721720
(4Z)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-1-[4-(4-methylpiperazin-1-yl)phenyl]-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 108721720) has the molecular formula C27H26ClN3O4S and a molecular weight of 524.04 g/mol. Its IUPAC name is (4Z)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-1-[4-(4-methylpiperazin-1-yl)phenyl]-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-1-[4-(4-methylpiperazin-1-yl)phenyl]-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108721720 |
| Molecular Formula | C27H26ClN3O4S |
| Molecular Weight | 524.04 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | (4Z)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-1-[4-(4-methylpiperazin-1-yl)phenyl]-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | COc1ccc(Cl)cc1/C(O)=C1/C(=O)C(=O)N(c2ccc(N3CCN(C)CC3)cc2)C1c1cccs1 |
| InChI | InChI=1S/C27H26ClN3O4S/c1-29-11-13-30(14-12-29)18-6-8-19(9-7-18)31-24(22-4-3-15-36-22)23(26(33)27(31)34)25(32)20-16-17(28)5-10-21(20)35-2/h3-10,15-16,24,32H,11-14H2,1-2H3/b25-23- |
| InChIKey | XWZGGOFYRPPDEJ-BZZOAKBMSA-N |
| XLogP | 4.79 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.04 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|