C28H27NO6S — CID 108722121
2-methylpropyl 4-[(4Z)-4-[hydroxy-(2-methoxy-5-methylphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]benzoate (PubChem CID 108722121) has the molecular formula C28H27NO6S and a molecular weight of 505.59 g/mol. Its IUPAC name is 2-methylpropyl 4-[(4Z)-4-[hydroxy-(2-methoxy-5-methylphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]benzoate.
| Compound Name | 2-methylpropyl 4-[(4Z)-4-[hydroxy-(2-methoxy-5-methylphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108722121 |
| Molecular Formula | C28H27NO6S |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | 2-methylpropyl 4-[(4Z)-4-[hydroxy-(2-methoxy-5-methylphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]benzoate |
| SMILES | COc1ccc(C)cc1/C(O)=C1/C(=O)C(=O)N(c2ccc(C(=O)OCC(C)C)cc2)C1c1cccs1 |
| InChI | InChI=1S/C28H27NO6S/c1-16(2)15-35-28(33)18-8-10-19(11-9-18)29-24(22-6-5-13-36-22)23(26(31)27(29)32)25(30)20-14-17(3)7-12-21(20)34-4/h5-14,16,24,30H,15H2,1-4H3/b25-23- |
| InChIKey | BKZDSZNLVASDLG-BZZOAKBMSA-N |
| XLogP | 5.50 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|