C26H21Cl2N3O6 — CID 108594095
N-[3-[(4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]phenyl]acetamide (PubChem CID 108594095) has the molecular formula C26H21Cl2N3O6 and a molecular weight of 542.38 g/mol. Its IUPAC name is N-[3-[(4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[3-[(4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 108594095 |
| Molecular Formula | C26H21Cl2N3O6 |
| Molecular Weight | 542.38 g/mol |
| Exact Mass | 541.08 |
| IUPAC Name | N-[3-[(4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]phenyl]acetamide |
| SMILES | COc1c(Cl)cc(/C(O)=C2\C(=O)C(=O)N(c3cccc(NC(C)=O)c3)C2c2ccncc2)c(OC)c1Cl |
| InChI | InChI=1S/C26H21Cl2N3O6/c1-13(32)30-15-5-4-6-16(11-15)31-21(14-7-9-29-10-8-14)19(23(34)26(31)35)22(33)17-12-18(27)25(37-3)20(28)24(17)36-2/h4-12,21,33H,1-3H3,(H,30,32)/b22-19+ |
| InChIKey | LPPNZNOSWLJHHP-ZBJSNUHESA-N |
| XLogP | 4.99 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.38 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|