C30H29Cl2NO6 — CID 108670745
(4E)-5-(4-tert-butylphenyl)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(3-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108670745) has the molecular formula C30H29Cl2NO6 and a molecular weight of 570.47 g/mol. Its IUPAC name is (4E)-5-(4-tert-butylphenyl)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(3-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-tert-butylphenyl)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(3-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108670745 |
| Molecular Formula | C30H29Cl2NO6 |
| Molecular Weight | 570.47 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | (4E)-5-(4-tert-butylphenyl)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(3-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cccc(N2C(=O)C(=O)/C(=C(/O)c3cc(Cl)c(OC)c(Cl)c3OC)C2c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C30H29Cl2NO6/c1-30(2,3)17-12-10-16(11-13-17)24-22(25(34)20-15-21(31)28(39-6)23(32)27(20)38-5)26(35)29(36)33(24)18-8-7-9-19(14-18)37-4/h7-15,24,34H,1-6H3/b25-22+ |
| InChIKey | UMKRBPIIIJUVFW-YYDJUVGSSA-N |
| XLogP | 6.94 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.47 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|